Introduction：Basic information about CAS 777-37-7|2-Chloro-5-nitrobenzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-5-nitrobenzotrifluoride |
|---|
| CAS Number | 777-37-7 | Molecular Weight | 225.552 |
|---|
| Density | 1.527 | Boiling Point | 231.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3ClF3NO2 | Melting Point | 22°C |
|---|
| MSDS | USA | Flash Point | 98 ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Chloro-5-nitrobenzotrifluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.527 |
|---|
| Boiling Point | 231.9±35.0 °C at 760 mmHg |
|---|
| Melting Point | 22°C |
|---|
| Molecular Formula | C7H3ClF3NO2 |
|---|
| Molecular Weight | 225.552 |
|---|
| Flash Point | 98 ºC |
|---|
| Exact Mass | 224.980438 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.41 |
|---|
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.508-1.51 |
|---|
| InChIKey | HQROXDLWVGFPDE-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C(F)(F)F)c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xn:Harmful |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 2810 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene, 1-chloro-4-nitro-2-(trifluoromethyl)- |
| Benzene, 1-chloro-4-nitro-2- (trifluoromethyl)- |
| 4-Chloro-3-(trifluoromethyl)nitrobenzene |
| 1-Chloro-4-nitro-2-(trifluoromethyl)benzene |
| WNR DG CXFFF |
| EINECS 212-287-1 |
| MFCD00007296 |
| 3-(Trifluoromethyl)-4chhloronitrobenzene |
| 2-Chloro-5-nitrobenzotrifluoride |
| 2-(Trifluoromethyl)-4-nitrochlorobenzene |
| 4-Nitro-2-(trifluoromethyl)chlorobenzene |
| Toluene, 2-chloro-α,α,α-trifluoro-5-nitro- |
| Sorafenib Impurity 23 |
