Introduction：Basic information about CAS 247113-91-3|2-fluoro-5-(trifluoromethyl)cinnamic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-fluoro-5-(trifluoromethyl)cinnamic acid |
|---|
| CAS Number | 247113-91-3 | Molecular Weight | 234.14700 |
|---|
| Density | 1.438g/cm3 | Boiling Point | 281.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H6F4O2 | Melting Point | 118-121°C |
|---|
| MSDS | / | Flash Point | 124.1ºC |
|---|
Names
| Name | (E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.438g/cm3 |
|---|
| Boiling Point | 281.6ºC at 760mmHg |
|---|
| Melting Point | 118-121°C |
|---|
| Molecular Formula | C10H6F4O2 |
|---|
| Molecular Weight | 234.14700 |
|---|
| Flash Point | 124.1ºC |
|---|
| Exact Mass | 234.03000 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.94230 |
|---|
| Vapour Pressure | 0.00167mmHg at 25°C |
|---|
| Index of Refraction | 1.51 |
|---|
| InChIKey | AUPRFUNTWIUZEA-DAFODLJHSA-N |
|---|
| SMILES | O=C(O)C=Cc1cc(C(F)(F)F)ccc1F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Fluoro-5-(trifluoromethyl)cinnamic acid |
| JRD-0577 |
| 3-(2-Fluoro-5-(trifluoromethyl)phenyl)acrylic acid |
| (2E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoic acid |
| MFCD00236293 |
