Introduction：Basic information about CAS 5855-98-1|2-(4-amino-3-sulphophenyl)-6-methylbenzothiazole-7-sulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-amino-3-sulphophenyl)-6-methylbenzothiazole-7-sulphonic acid |
|---|
| CAS Number | 5855-98-1 | Molecular Weight | 400.45000 |
|---|
| Density | 1.699g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H12N2O6S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(4-amino-3-sulfophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.699g/cm3 |
|---|
| Molecular Formula | C14H12N2O6S3 |
|---|
| Molecular Weight | 400.45000 |
|---|
| Exact Mass | 399.98600 |
|---|
| PSA | 192.65000 |
|---|
| LogP | 5.09010 |
|---|
| Index of Refraction | 1.728 |
|---|
| InChIKey | ANZCWTMNWQPOQI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2nc(-c3ccc(N)c(S(=O)(=O)O)c3)sc2c1S(=O)(=O)O |
|---|
Synonyms
| EINECS 227-471-7 |
| 2-(4-amino-3-sulfo-phenyl)-6-methyl-benzothiazole-7-sulfonic acid |
| 2-(4'-Aminophenyl)-6-methylbenzene-thiazole-3',7-disulfonic acid |
| 2-(4-Amino-3-sulfo-phenyl)-6-methyl-benzothiazol-7-sulfonsaeure |
| 7-benzothiazolesulfonic acid,2-(4-amino-3-sulfophenyl)-6-methyl |
