Introduction：Basic information about CAS 499785-53-4|2-(chloromethyl)-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(chloromethyl)-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|
| CAS Number | 499785-53-4 | Molecular Weight | 277.69300 |
|---|
| Density | 1.398g/cm3 | Boiling Point | 320.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7ClF3NS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.4ºC |
|---|
Names
| Name | 2-(chloromethyl)-4-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.398g/cm3 |
|---|
| Boiling Point | 320.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7ClF3NS |
|---|
| Molecular Weight | 277.69300 |
|---|
| Flash Point | 147.4ºC |
|---|
| Exact Mass | 276.99400 |
|---|
| PSA | 41.13000 |
|---|
| LogP | 4.56770 |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | NSHFNNYKHBYRDL-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(-c2csc(CCl)n2)cc1 |
|---|
Synonyms
| 2-(3-hydroxy-phenyl)-1,3-dioxo-2,3-dihydro-1h-isoindole-5-carboxylic acid |
| 2-(chloromethyl)-4-(4-(trifluoromethyl)phenyl)-1,3-thiazole |
