Introduction：Basic information about CAS 79458-92-7|Z-Ala-His-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Ala-His-OH |
|---|
| CAS Number | 79458-92-7 | Molecular Weight | 360.365 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 745.2±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H20N4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 404.5±32.9 °C |
|---|
Names
| Name | Cbz-Ala-His-OH |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 745.2±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H20N4O5 |
|---|
| Molecular Weight | 360.365 |
|---|
| Flash Point | 404.5±32.9 °C |
|---|
| Exact Mass | 360.143372 |
|---|
| PSA | 133.41000 |
|---|
| LogP | 0.70 |
|---|
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | YBPCRFFMGCXYQW-FZMZJTMJSA-N |
|---|
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
|---|
Synonyms
| Z-ALA-HIS-OH |
| N-[(Benzyloxy)carbonyl]-L-alanyl-L-histidine |
| L-Histidine, N-[(phenylmethoxy)carbonyl]-L-alanyl- |
| N-(Benzyloxycarbonyl-L-ananyl)-L-histidine |
| (benzyloxycarbonyl)-L-alanyl-L-histidine |
| N-[N-[(Phenylmethoxy)carbonyl]-L-alanyl]-L-histidine |
