Introduction：Basic information about CAS 7764-29-6|N,N'-Thiodiphthalimide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-Thiodiphthalimide |
|---|
| CAS Number | 7764-29-6 | Molecular Weight | 324.311 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 553.0±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H8N2O4S | Melting Point | 214-218ºC(lit.) |
|---|
| MSDS | / | Flash Point | 288.3±25.4 °C |
|---|
Names
| Name | 2-(1,3-dioxoisoindol-2-yl)sulfanylisoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 553.0±33.0 °C at 760 mmHg |
|---|
| Melting Point | 214-218ºC(lit.) |
|---|
| Molecular Formula | C16H8N2O4S |
|---|
| Molecular Weight | 324.311 |
|---|
| Flash Point | 288.3±25.4 °C |
|---|
| Exact Mass | 324.020477 |
|---|
| PSA | 100.06000 |
|---|
| LogP | 2.30 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.800 |
|---|
| InChIKey | QYIWBOWEQBEAGP-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1SN1C(=O)c2ccccc2C1=O |
|---|
Safety Information
Synonyms
| N,N'-sulfanediyl-bis-phthalimide |
| N,N'-Thiodiphthalimide |
| 2,2'-Sulfanediylbis(1H-isoindole-1,3(2H)-dione) |
| thiobisphthalimide |
| EINECS 231-856-5 |
| N-(phthalimidethio)phthalimide |
| thiobisphtalmide |
| 1H-Isoindole-1,3(2H)-dione, 2,2'-thiobis- |
| N,N-thiobisphthalimide |
