Introduction:Basic information about CAS 3247-00-5|Benzenemethanol,4-methyl-a,a-bis(4-methylphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenemethanol,4-methyl-a,a-bis(4-methylphenyl)- |
|---|
| CAS Number | 3247-00-5 | Molecular Weight | 302.40900 |
|---|
| Density | 1.083g/cm3 | Boiling Point | 459.1ºC at 760mmHg |
|---|
| Molecular Formula | C22H22O | Melting Point | 94-96ºC |
|---|
| MSDS | / | Flash Point | 173.5ºC |
|---|
Names
| Name | tris(4-methylphenyl)methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.083g/cm3 |
|---|
| Boiling Point | 459.1ºC at 760mmHg |
|---|
| Melting Point | 94-96ºC |
|---|
| Molecular Formula | C22H22O |
|---|
| Molecular Weight | 302.40900 |
|---|
| Flash Point | 173.5ºC |
|---|
| Exact Mass | 302.16700 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.89600 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | DNWQXZDDISHGRM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| Methanol,tri-p-tolyl |
| TRI-P-TOLYL-METHANOL |
| 4,4',4''-trimethyltriphenylmethanol |
| 4,4',4''-Trimethyltrityl alcohol |
| EINECS 221-822-8 |
| MFCD00014919 |
| tri-p-tolylcarbinol |