Introduction：Basic information about CAS 33901-46-1|4-nitrophenoxyacetonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-nitrophenoxyacetonitrile |
|---|
| CAS Number | 33901-46-1 | Molecular Weight | 178.14500 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 363.9ºC at 760mmHg |
|---|
| Molecular Formula | C8H6N2O3 | Melting Point | 74-76°C |
|---|
| MSDS | / | Flash Point | 173.9ºC |
|---|
Names
| Name | 2-(4-nitrophenoxy)acetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 363.9ºC at 760mmHg |
|---|
| Melting Point | 74-76°C |
|---|
| Molecular Formula | C8H6N2O3 |
|---|
| Molecular Weight | 178.14500 |
|---|
| Flash Point | 173.9ºC |
|---|
| Exact Mass | 178.03800 |
|---|
| PSA | 78.84000 |
|---|
| LogP | 2.02038 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | HFRYXZNUOFIXGS-UHFFFAOYSA-N |
|---|
| SMILES | N#CCOc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
| Risk Phrases | R20/22 |
|---|
| Safety Phrases | S22-S36/37/39 |
|---|
| RIDADR | 3276 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
Synonyms
| p-nitrophenoxyacetonitrile |
| 4-cyanomethyleneoxynitrobenzene |
| (4-nitrophenoxy)acetonitrile |
| O-cyanomethyl-4-nitrophenol |
| MFCD00068120 |
| 2-(4-nitrophenoxy)ethanenitrile |
