Introduction：Basic information about CAS 18529-03-8|7-Fluoro-2-methylquinolin-4-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Fluoro-2-methylquinolin-4-ol |
|---|
| CAS Number | 18529-03-8 | Molecular Weight | 177.175 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 272.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8FNO | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 118.3±27.3 °C |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 7-fluoro-2-methyl-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 272.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8FNO |
|---|
| Molecular Weight | 177.175 |
|---|
| Flash Point | 118.3±27.3 °C |
|---|
| Exact Mass | 177.058990 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.58 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | DGZLIRLGDGAYDG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c2ccc(F)cc2[nH]1 |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 7-Fluoro-4-hydroxy-2-methylquinoline |
| 4-Hydroxy-7-fluor-2-methyl-chinolin |
| 4-quinolinol, 7-fluoro-2-methyl- |
| 7-Fluoro-2-methyl-4(1H)-quinolinone |
| 7-Fluoro-2-methylquinolin-4-ol |
| 4-Quinolinol,7-fluoro-2-methyl |
| 4(1H)-Quinolinone, 7-fluoro-2-methyl- |
