Introduction:Basic information about CAS 78016-98-5|2-(trifluoromethyl)-1H-imidazole-5-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(trifluoromethyl)-1H-imidazole-5-carboxylic acid |
|---|
| CAS Number | 78016-98-5 | Molecular Weight | 180.08500 |
|---|
| Density | 1.682 | Boiling Point | 350.7ºC at 760 mmHg |
|---|
| Molecular Formula | C5H3F3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.9ºC |
|---|
Names
| Name | 2-(trifluoromethyl)-1H-imidazole-5-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.682 |
|---|
| Boiling Point | 350.7ºC at 760 mmHg |
|---|
| Molecular Formula | C5H3F3N2O2 |
|---|
| Molecular Weight | 180.08500 |
|---|
| Flash Point | 165.9ºC |
|---|
| Exact Mass | 180.01500 |
|---|
| PSA | 65.98000 |
|---|
| LogP | 1.12670 |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | DQPSZGHYQKCZEY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cnc(C(F)(F)F)[nH]1 |
|---|
Synonyms
| 2-Trifluoromethylimidazole-4-carboxylic acid |