Introduction：Basic information about CAS 343604-38-6|3-(4-fluoro-3-methylphenyl)benzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-fluoro-3-methylphenyl)benzaldehyde |
|---|
| CAS Number | 343604-38-6 | Molecular Weight | 214.23500 |
|---|
| Density | 1.146g/cm3 | Boiling Point | 334.339ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11FO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.338ºC |
|---|
Names
| Name | 3-(4-fluoro-3-methylphenyl)benzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.146g/cm3 |
|---|
| Boiling Point | 334.339ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11FO |
|---|
| Molecular Weight | 214.23500 |
|---|
| Flash Point | 227.338ºC |
|---|
| Exact Mass | 214.07900 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.61360 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | IFMWARRXRDWXBH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(-c2cccc(C=O)c2)ccc1F |
|---|
