Introduction:Basic information about CAS 656305-82-7|3-(3,5-dichlorophenyl)benzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3,5-dichlorophenyl)benzaldehyde |
|---|
| CAS Number | 656305-82-7 | Molecular Weight | 251.10800 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 391.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8Cl2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.4ºC |
|---|
Names
| Name | 3-(3,5-dichlorophenyl)benzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 391.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8Cl2O |
|---|
| Molecular Weight | 251.10800 |
|---|
| Flash Point | 165.4ºC |
|---|
| Exact Mass | 249.99500 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.47290 |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | NYQHTXXDYQXIAM-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cccc(-c2cc(Cl)cc(Cl)c2)c1 |
|---|