Introduction：Basic information about CAS 82419-52-1|Ofloxacin impurity E, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ofloxacin impurity E |
|---|
| CAS Number | 82419-52-1 | Molecular Weight | 347.34100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C17H18FN3O4 | Melting Point | >250ºC (dec.) |
|---|
| MSDS | / | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | N-Demethylofloxacin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >250ºC (dec.) |
|---|
| Molecular Formula | C17H18FN3O4 |
|---|
| Molecular Weight | 347.34100 |
|---|
| Exact Mass | 347.12800 |
|---|
| PSA | 83.80000 |
|---|
| LogP | 1.59560 |
|---|
| InChIKey | WKRSSAPQZDHYRV-UHFFFAOYSA-N |
|---|
| SMILES | CC1COc2c(N3CCNCC3)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
|---|
| Storage condition | -20?C Freezer |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Precautionary Statements | P301 + P312 + P330 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Ofloxacin related compound A |
| N-desmethyl ofloxacin |
| N-demethyl ofloxacin |
| UNII-5S4363I4ED |
