Introduction:Basic information about CAS 343564-14-7|1-[4-Amino-3-(trifluoromethyl)phenyl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[4-Amino-3-(trifluoromethyl)phenyl]ethanone |
|---|
| CAS Number | 343564-14-7 | Molecular Weight | 203.161 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 271.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8F3NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 118.2±25.9 °C |
|---|
Names
| Name | 1-[4-amino-3-(trifluoromethyl)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 271.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8F3NO |
|---|
| Molecular Weight | 203.161 |
|---|
| Flash Point | 118.2±25.9 °C |
|---|
| Exact Mass | 203.055801 |
|---|
| PSA | 43.09000 |
|---|
| LogP | 2.37 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | TXFXQCKJRBOBDW-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(N)c(C(F)(F)F)c1 |
|---|
Synonyms
| Ethanone,1-[4-amino-3-(trifluoromethyl)phenyl] |
| 1-(4-amino-3-(trifluoromethyl)phenyl)ethanone |
| Ethanone, 1-[4-amino-3-(trifluoromethyl)phenyl]- |
| 1-[4-amino-3-(trifluoromethyl)phenyl]-1-ethanone |
| 1-[4-Amino-3-(trifluoromethyl)phenyl]ethanone |
| 1-[4-azanyl-3-(trifluoromethyl)phenyl]ethanone |