Introduction：Basic information about CAS 98769-74-5|3-Amino-1-(2-ethoxyphenoxy)-1-phenyl-2-propanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Amino-1-(2-ethoxyphenoxy)-1-phenyl-2-propanol |
|---|
| CAS Number | 98769-74-5 | Molecular Weight | 287.353 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 468.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H21NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237.4±28.7 °C |
|---|
Names
| Name | 3-Amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 468.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H21NO3 |
|---|
| Molecular Weight | 287.353 |
|---|
| Flash Point | 237.4±28.7 °C |
|---|
| Exact Mass | 287.152130 |
|---|
| PSA | 64.71000 |
|---|
| LogP | 2.74 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | NSRLBJFRMMPGOK-RHSMWYFYSA-N |
|---|
| SMILES | CCOc1ccccc1OC(c1ccccc1)C(O)CN |
|---|
Synonyms
| (2RS,3RS)-1-amino-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropane |
| (2RS,3RS)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylamine |
| 3-Amino-1-(2-ethoxyphenoxy)-1-phenylpropan-2-ol |
| 3-amino-1-(2-ethoxy-phenoxy)-1-phenylpropan-2-ol |
| Benzeneethanol, α-(aminomethyl)-β-(2-ethoxyphenoxy)- |
| 3-Amino-1-(2-ethoxyphenoxy)-1-phenyl-2-propanol |
