Introduction：Basic information about CAS 632327-19-6|Methyl 3-(3-chlorophenyl)-3-oxopropanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 3-(3-chlorophenyl)-3-oxopropanoate |
|---|
| CAS Number | 632327-19-6 | Molecular Weight | 212.630 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 297.3±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 124.6±20.8 °C |
|---|
Names
| Name | methyl 3-(3-chlorophenyl)-3-oxopropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 297.3±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9ClO3 |
|---|
| Molecular Weight | 212.630 |
|---|
| Flash Point | 124.6±20.8 °C |
|---|
| Exact Mass | 212.024017 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.18 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | MDZSDWBDIPJXKR-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)CC(=O)c1cccc(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3-(3-Chlor-phenyl)-3-oxo-propionsaeure-methylester |
| 3-(3-Chloro-phenyl)-3-oxo-propionic acid methyl ester |
| methyl 3-(3'-chlorophenyl)-3-oxo-propanoate |
| Methyl 3-(3-chlorophenyl)-3-oxopropanoate |
| methyl 3-(3'-chlorophenyl)-3-oxo-propionate |
| 3-Chlor-benzoylessigsaeure-methylester |
| Benzenepropanoic acid, 3-chloro-β-oxo-, methyl ester |
| 3-oxo-3-(3-chloro-phenyl)-propionic acid methyl ester |
| 3-Chloro-b-oxo-benzenepropanoic acid methyl ester |
