Introduction:Basic information about CAS 497-95-0|Chrysanthemumdicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chrysanthemumdicarboxylic acid |
|---|
| CAS Number | 497-95-0 | Molecular Weight | 198.21600 |
|---|
| Density | 1.315g/cm3 | Boiling Point | 378.5ºC at 760mmHg |
|---|
| Molecular Formula | C10H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Chrysanthemumdicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.315g/cm3 |
|---|
| Boiling Point | 378.5ºC at 760mmHg |
|---|
| Molecular Formula | C10H14O4 |
|---|
| Molecular Weight | 198.21600 |
|---|
| Exact Mass | 198.08900 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.37410 |
|---|
| Vapour Pressure | 8.95E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | XXTFGUFRXPWYDA-SNAWJCMRSA-N |
|---|
| SMILES | CC(=CC1C(C(=O)O)C1(C)C)C(=O)O |
|---|
Synonyms
| E,E-Chrysanthemumdicarbonsaeure |
| Chysanthemumdicarboxylic acid |