Introduction:Basic information about CAS 5836-54-4|3,4-Dichloro-n-methylbenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-Dichloro-n-methylbenzenesulfonamide |
|---|
| CAS Number | 5836-54-4 | Molecular Weight | 240.10700 |
|---|
| Density | 1.464g/cm3 | Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C7H7Cl2NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.1ºC |
|---|
Names
| Name | 3,4-Dichloro-N-methyl-benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.464g/cm3 |
|---|
| Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C7H7Cl2NO2S |
|---|
| Molecular Weight | 240.10700 |
|---|
| Flash Point | 167.1ºC |
|---|
| Exact Mass | 238.95700 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 3.37320 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | HRRNFMGIBBKSTL-UHFFFAOYSA-N |
|---|
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 3.4-Dichlor-N-methyl-benzolsulfonamid |
| 4-Methylsulfamoyl-1.2-dichlor-benzol |
| 3,4-dichloro-benzenesulfonic acid ethylamide |
| N-Aethyl-3.4-dichlor-benzolsulfonamid |
| 3,4-dichlorobenzoic di-sec-butylamide |
| 3,4-Dichloro-N,N-di-sec-butylbenzamide |
| 3,4-Dichlor-benzolsulfonsaeure-aethylamid |
| 3.4-Dichlorbenzoesaeure-di-sek.-butylamid |
| 3,4-Dichlor-benzolsulfonsaeure-methylamid |
| 3,4-dichloro-N-methylbenzene-sulfonamide |
| 3,4-dichloro-benzenesulfonic acid methylamide |
| 4-Aethylsulfamoyl-1.2-dichlor-benzol |