Introduction：Basic information about CAS 49633-28-5|Benzenesulfonamide,N,N'-1,2-phenylenebis[4-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide,N,N'-1,2-phenylenebis[4-methyl- |
|---|
| CAS Number | 49633-28-5 | Molecular Weight | 416.51400 |
|---|
| Density | 1.387g/cm3 | Boiling Point | 585.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H20N2O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 308.1ºC |
|---|
Names
| Name | 4-methyl-N-[2-[(4-methylphenyl)sulfonylamino]phenyl]benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.387g/cm3 |
|---|
| Boiling Point | 585.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H20N2O4S2 |
|---|
| Molecular Weight | 416.51400 |
|---|
| Flash Point | 308.1ºC |
|---|
| Exact Mass | 416.08600 |
|---|
| PSA | 109.10000 |
|---|
| LogP | 6.21260 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | URBKDTWJYJXMOZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2NS(=O)(=O)c2ccc(C)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N,N'-di(p-toluenesulfonyl)-o-phenylenediamine |
| N,N'-di(p-toluenesulufonyl)-o-phenylenediamine |
| N,N'-1,2-phenylenebis(4-methyl benzenesulfonamide) |
| N,N'-bistoluene-p-sulfonyl-o-phenylenediamine |
| N,N'-(O-Phenylene)bis(p-toluenesulfonamide) |
| 4-methyl-N-(2-{[(4-methylphenyl)sulfonyl]amino}phenyl)benzenesulfonamide |
| N,N'-(o-phenylene)bis(toluene-p-sulfonamide) |
