Introduction：Basic information about CAS 454-95-5|Benzoic acid,3-(fluorosulfonyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,3-(fluorosulfonyl)- |
|---|
| CAS Number | 454-95-5 | Molecular Weight | 204.17600 |
|---|
| Density | 1.538g/cm3 | Boiling Point | 358.8ºC at 760mmHg |
|---|
| Molecular Formula | C7H5FO4S | Melting Point | 147-153 ℃ |
|---|
| MSDS | ChineseUSA | Flash Point | 170.8ºC |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 3-fluorosulfonylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.538g/cm3 |
|---|
| Boiling Point | 358.8ºC at 760mmHg |
|---|
| Melting Point | 147-153 ℃ |
|---|
| Molecular Formula | C7H5FO4S |
|---|
| Molecular Weight | 204.17600 |
|---|
| Flash Point | 170.8ºC |
|---|
| Exact Mass | 203.98900 |
|---|
| PSA | 79.82000 |
|---|
| LogP | 2.12380 |
|---|
| Vapour Pressure | 8.96E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | VWYMBWGOJRULOV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(S(=O)(=O)F)c1 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
|---|
| Hazard Codes | C |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 1759 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Fluorsulfonyl-benzoesaeure |
