Introduction:Basic information about CAS 4711-00-6|(3aR,5R,5aS,8aS,8bR)-5-(azidomethyl)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydro-3aH-di[, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3aR,5R,5aS,8aS,8bR)-5-(azidomethyl)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydro-3aH-di[1,3]dioxolo[4,5-a:5',4'-d]pyran |
|---|
| CAS Number | 4711-00-6 | Molecular Weight | 285.29600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H19N3O5 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07, GHS08 | Signal Word | Warning |
|---|
Names
| Name | (3aR,5R,5aS,8aS,8bR)-5-(azidomethyl)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydro-3aH-di[1,3]dioxolo[4,5-a:5',4'-d]pyran |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H19N3O5 |
|---|
| Molecular Weight | 285.29600 |
|---|
| Exact Mass | 285.13200 |
|---|
| PSA | 95.90000 |
|---|
| LogP | 1.14596 |
|---|
| InChIKey | KIBLVBPHQCVUFG-YBEHEVOFSA-N |
|---|
| SMILES | CC1(C)OC2OC(CN=[N+]=[N-])C3OC(C)(C)OC3C2O1 |
|---|
Safety Information
| Symbol | GHS07, GHS08 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335-H341 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 1,2:3,4-Di-O-isopropylidene-6-deoxy-6-azido-Alpha-D-galactopyranose |
| 6-Azido-6-deoxy-1,2:3,4-di-O-isopropylidene-a-D-galactopyranose |
| 6-AZIDO-6-DEOXY-1,2:3,4-DI-O-ISOPROPYLIDENE-D-GALACTOPYRANOSIDE |