Introduction:Basic information about CAS 78452-55-8|N-(tert-Butoxycarbonyl)-3-(2-thienyl)-L-alanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(tert-Butoxycarbonyl)-3-(2-thienyl)-L-alanine |
|---|
| CAS Number | 78452-55-8 | Molecular Weight | 271.333 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 424.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H17NO4S | Melting Point | 69 - 72 °C |
|---|
| MSDS | USA | Flash Point | 210.8±27.3 °C |
|---|
Names
| Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 424.9±40.0 °C at 760 mmHg |
|---|
| Melting Point | 69 - 72 °C |
|---|
| Molecular Formula | C12H17NO4S |
|---|
| Molecular Weight | 271.333 |
|---|
| Flash Point | 210.8±27.3 °C |
|---|
| Exact Mass | 271.087830 |
|---|
| PSA | 103.87000 |
|---|
| LogP | 2.77 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | OJLISTAWQHSIHL-SECBINFHSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1cccs1)C(=O)O |
|---|
| Storage condition | Store at 0-5°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| N-(tert-butoxycarbonyl)-3-(thien-2-yl)-L-alanine |
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-yl-propanoate |
| Boc-L-3-(2-Thienyl)-alanine |
| Boc-3-(2-Thienyl)-D-alanine |
| MFCD00065591 |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-(thiophen-2-yl)propanoic acid |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-(2-thienyl)alanine |
| (2S)-2-[(tert-butoxycarbonyl)amino]-3-(thiophen-2-yl)propanoic acid |
| Boc-L-2-Thienylalanine |
| N-(t-butoxycarbonyl)-3-(thien-2-yl)-DL-alanine |
| 2-Thiopheneacetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-, (αS)- |
| (R)-N-(tert-butoxycarbonyl)-3-(thiophen-2-yl)alanine |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-thienyl)propanoic acid |
| Boc(2-thienyl)alanine |
| N-(tert-Butoxycarbonyl)-3-(2-thienyl)-L-alanine |
| (2R)-2-(tert-Butoxycarbonylamino)-3-(thiophen-2-yl)propionic acid |
| (R)-2-tert-butoxycarbonylamino-3-thiophen-2-yl-propionic acid |
| 2-Thiophenepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-, (αS)- |
| Boc-3-(2-thienyl)-L-alanine |
| (2R)-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]-3-thiophen-2-ylpropanoate |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-(2-thienyl)-L-alanine |
| N-(tert-butoxycarbonyl)-3-thiophen-2-yl-L-alanine |
| Boc-3-D-Ala(2-thienyl)-OH |