Introduction:Basic information about CAS 239074-29-4|(trans-4-Hydroxymethylcyclohexyl)carbamic acid tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (trans-4-Hydroxymethylcyclohexyl)carbamic acid tert-butyl ester |
|---|
| CAS Number | 239074-29-4 | Molecular Weight | 229.316 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 351.6±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H23NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.4±19.3 °C |
|---|
Names
| Name | tert-butyl N-[4-(hydroxymethyl)cyclohexyl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 351.6±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H23NO3 |
|---|
| Molecular Weight | 229.316 |
|---|
| Flash Point | 166.4±19.3 °C |
|---|
| Exact Mass | 229.167801 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 1.66 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | SGNKPJPMWHKOJO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC1CCC(CO)CC1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Methyl-2-propanyl [trans-4-(hydroxymethyl)cyclohexyl]carbamate |
| N-tert-butoxy-carbonyl-trans-4-(hydroxymethyl)cyclohexylamine |
| tert-butyl (trans-4-(hydroxymethyl)cyclohexyl)carbamate |
| Carbamic acid, N-[trans-4-(hydroxymethyl)cyclohexyl]-, 1,1-dimethylethyl ester |
| trans (4-hydroxymethyl-cyclohexyl)-carbamic acid tert-butyl ester |
| trans-(4-Boc-Aminocyclohexyl)methanol |
| tert-butyl (1r,4r)-4-(hydroxymethyl)cyclohexylcarbamate |
| tert-Butyl [trans-4-(hydroxymethyl)cyclohexyl]carbamate |
| trans-1-(Boc-Amino)-4-(hydroxymethyl)cyclohexane |
| cis-(4-Boc-Aminocyclohexyl)methanol |
| 1,1-dimethylethyl [trans-4-(hydroxymethyl)cyclohexyl]carbamate |
| Tert-Butyl Trans-(4-HydroxyMethyl)CyclohexylcarbaMate |
| (trans-4-Hydroxymethylcyclohexyl)carbamic acid tert-butyl ester |