Introduction：Basic information about CAS 778593-53-6|4-[(4-Ethynylphenyl)ethynyl]-N,N-dimethylaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(4-Ethynylphenyl)ethynyl]-N,N-dimethylaniline |
|---|
| CAS Number | 778593-53-6 | Molecular Weight | 245.318 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 389.1±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H15N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.5±20.6 °C |
|---|
Names
| Name | 4-[2-(4-ethynylphenyl)ethynyl]-N,N-dimethylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 389.1±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H15N |
|---|
| Molecular Weight | 245.318 |
|---|
| Flash Point | 169.5±20.6 °C |
|---|
| Exact Mass | 245.120453 |
|---|
| PSA | 3.24000 |
|---|
| LogP | 5.07 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | VULMLGBRQJQGIW-UHFFFAOYSA-N |
|---|
| SMILES | C#Cc1ccc(C#Cc2ccc(N(C)C)cc2)cc1 |
|---|
Synonyms
| 4-[(4-Ethynylphenyl)ethynyl]-N,N-dimethylaniline |
| [4-(4-ethynyl-phenylethynyl)phenyl]dimethylamine |
| 4-(4-ethynylphenylethynyl)-N,N-dimethylaniline |
| 4-((4-ethynylphenyl)ethynyl)-N,N-dimethylbenzenamine |
| Benzenamine, 4-[2-(4-ethynylphenyl)ethynyl]-N,N-dimethyl- |
| 1-(p-N,N-dimethylaminophenyl)-2-(p-ethynylphenyl)ethyne |
