Introduction：Basic information about CAS 330562-49-7|perfluoro-1,9-dibromo-2,5,6-trioxanonane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluoro-1,9-dibromo-2,5,6-trioxanonane |
|---|
| CAS Number | 330562-49-7 | Molecular Weight | 507.85100 |
|---|
| Density | 2.127g/cm3 | Boiling Point | 52/25mm |
|---|
| Molecular Formula | C6Br2F12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 115.3ºC |
|---|
Names
| Name | 1-[bromo(difluoro)methoxy]-2-[2-[bromo(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.127g/cm3 |
|---|
| Boiling Point | 52/25mm |
|---|
| Molecular Formula | C6Br2F12O3 |
|---|
| Molecular Weight | 507.85100 |
|---|
| Flash Point | 115.3ºC |
|---|
| Exact Mass | 505.80200 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 5.29780 |
|---|
| Index of Refraction | 1.357 |
|---|
| InChIKey | MYPXRCQEBQPETF-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(Br)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)Br |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| MFCD03412265 |
| Perfluoro-1,9-dibromo-2,5,8-trioxanonane |
| PC2472 |
| 1,9-dibromoperfluoro-2,5,8-trioxanonane |
