Introduction：Basic information about CAS 891182-24-4|3,7-Dibromo-5,5-dioctyl-5H-dibenzo[b,d]silole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,7-Dibromo-5,5-dioctyl-5H-dibenzo[b,d]silole |
|---|
| CAS Number | 891182-24-4 | Molecular Weight | 564.511 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 566.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H40Br2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 462.3±25.1 °C |
|---|
Names
| Name | 3,7-dibromo-5,5-dioctylbenzo[b][1]benzosilole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 566.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H40Br2Si |
|---|
| Molecular Weight | 564.511 |
|---|
| Flash Point | 462.3±25.1 °C |
|---|
| Exact Mass | 562.126587 |
|---|
| LogP | 9.47600 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | FPSGCUROGVMFJQ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCC[Si]1(CCCCCCCC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
|---|
Synonyms
| 2,7-dibromo-9,9'-di-n-octyldibenzosilole |
| 3,7-Dibromo-5,5-dioctyl-5H-dibenzo[b,d]silole |
| 3,7-dibromo-5,5-dioctyl-dibenzo[b,d]silole |
| 2,7-Dibromo-9,9-dioctyl-9H-9-silafluorene |
| 2,7-dibromo-9,9-dioctyldibenzosilole |
| 3,7-dibromo-5,5-di-n-octyl-dibenzo[b,d]silole |
| 5H-Dibenzo[b,d]silole, 3,7-dibromo-5,5-dioctyl- |
