Introduction：Basic information about CAS 717917-14-1|2-Methyl-6-[(4-methylphenyl)sulfonyl]-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-6-[(4-methylphenyl)sulfonyl]-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine |
|---|
| CAS Number | 717917-14-1 | Molecular Weight | 353.438 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 639.5±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H19N3O2S | Melting Point | 111-112ºC |
|---|
| MSDS | / | Flash Point | 340.5±34.3 °C |
|---|
Names
| Name | 2-Methyl-6-[(4-methylphenyl)sulfonyl]-3,4,5,6-tetrahydroimidazo[4 ,5-d][1]benzazepine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 639.5±65.0 °C at 760 mmHg |
|---|
| Melting Point | 111-112ºC |
|---|
| Molecular Formula | C19H19N3O2S |
|---|
| Molecular Weight | 353.438 |
|---|
| Flash Point | 340.5±34.3 °C |
|---|
| Exact Mass | 353.119812 |
|---|
| PSA | 74.44000 |
|---|
| LogP | 2.15 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.650 |
|---|
| InChIKey | FJMULJYPXDDJSY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3[nH]c(C)nc3-c3ccccc32)cc1 |
|---|
Synonyms
| Imidazo[4,5-d][1]benzazepine, 3,4,5,6-tetrahydro-2-methyl-6-[(4-methylphenyl)sulfonyl]- |
| 2-Methyl-6-[(4-methylphenyl)sulfonyl]-3,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine |
| 2-methyl-6-[(4-methylphenyl)sulfonyl]-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine |
| Conivaptan Impurity 6 |
