Introduction:Basic information about CAS 18866-78-9|colterol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | colterol |
|---|
| CAS Number | 18866-78-9 | Molecular Weight | 225.28400 |
|---|
| Density | 1.171g/cm3 | Boiling Point | 419.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.3ºC |
|---|
Names
| Name | colterol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.171g/cm3 |
|---|
| Boiling Point | 419.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H19NO3 |
|---|
| Molecular Weight | 225.28400 |
|---|
| Flash Point | 165.3ºC |
|---|
| Exact Mass | 225.13600 |
|---|
| PSA | 72.72000 |
|---|
| LogP | 1.91020 |
|---|
| Vapour Pressure | 8.92E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | PHSMOUBHYUFTDM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(O)c1 |
|---|
Safety Information
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1H-Indene-1-carboxylic acid,6-chloro-5-cyclohexyl-2,3-dihydro-(9ci) |
| N-tert-butyl-2-(3,4-dihydroxyphenyl)-2-hydroxyethylamine |
| Indanal |
| (+-)-6-Chlor-5-cyclohexyl-1-indancarbonsaeure |
| 6-Chloro-5-cyclohexyl-1-indancarboxylic acid |
| Britai |
| 6-chloro-5-cyclohexylindan-1-carboxylic acid |
| (+/-)-Colterol |
| 2-tert-butylamino-1-(3,4-dihydroxy-phenyl)-ethanol |
| 6-chloro-5-cyclohexyl-2,3-dihydro-1H-indene-1-carboxylic acid |
| (+/-)-Clidanac |
| 4-{1-Hydroxy-2-[(2-methyl-2-propanyl)amino]ethyl}-1,2-benzenediol |
| (+-)-6-Chlor-5-cyclohexylindan-1-carbonsaeure |
| 2-tert-Butylamino-1-(3,4-dihydroxy-phenyl)-aethanol |