Introduction：Basic information about CAS 98948-82-4|8-hydroxy-4,5,6-trioxo-1H-quinoline-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-hydroxy-4,5,6-trioxo-1H-quinoline-2-carboxylic acid |
|---|
| CAS Number | 98948-82-4 | Molecular Weight | 235.15000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H5NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 8-hydroxy-4,5,6-trioxo-1H-quinoline-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H5NO6 |
|---|
| Molecular Weight | 235.15000 |
|---|
| Exact Mass | 235.01200 |
|---|
| PSA | 124.79000 |
|---|
| LogP | 0.30630 |
|---|
| InChIKey | QDPBTTYWHGQEIJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C=C(O)c2[nH]c(C(=O)O)cc(=O)c2C1=O |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4,6-Dihydroxy-chinolinchinon-(5,8)-carbonsaeure-(2) |
| 4,6-dihydroxyquinoline-5,8-dione-2 carboxylic acid |
| I08-0415 |
| 4,6-Dihydroxy-5,8-dioxo-5,8-dihydro-chinolin-2-carbonsaeure |
| 4,6-dihydroxy-5,8-dioxo-5,8-dihydro-quinoline-2-carboxylic acid |
