Introduction：Basic information about CAS 793035-88-8|AG-L-59687, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | AG-L-59687 |
|---|
| CAS Number | 793035-88-8 | Molecular Weight | 616.525 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 847.4±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H34BrN5O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 466.3±37.1 °C |
|---|
Names
| Name | 2-[8-[2-amino-6-[(4-bromothiophen-2-yl)methoxy]purin-9-yl]octoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 847.4±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H34BrN5O7S |
|---|
| Molecular Weight | 616.525 |
|---|
| Flash Point | 466.3±37.1 °C |
|---|
| Exact Mass | 615.136230 |
|---|
| PSA | 207.20000 |
|---|
| LogP | 1.98 |
|---|
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.708 |
|---|
| InChIKey | WAAZBVOGWRQLMB-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(OCc2cc(Br)cs2)c2ncn(CCCCCCCCOC3OC(CO)C(O)C(O)C3O)c2n1 |
|---|
Synonyms
| 2-{8-[2-Amino-6-(4-bromo-thiophen-2-ylmethoxy)-purin-9-yl]-octyloxy}-6-hydroxymethyl-tetrahydro-pyran-3,4,5-triol |
| Y0370 |
| 8-{2-Amino-6-[(4-bromo-2-thienyl)methoxy]-9H-purin-9-yl}octyl hexopyranoside |
| Hexopyranoside, 8-[2-amino-6-[(4-bromo-2-thienyl)methoxy]-9H-purin-9-yl]octyl |
| AG-L-59687 |
