Introduction：Basic information about CAS 188417-26-7|2-Ethoxy-4-formylphenyl 2-methylpropanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Ethoxy-4-formylphenyl 2-methylpropanoate |
|---|
| CAS Number | 188417-26-7 | Molecular Weight | 236.264 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 328.5±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.4±23.8 °C |
|---|
Names
| Name | Ethyl vanillin isobutyrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 328.5±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16O4 |
|---|
| Molecular Weight | 236.264 |
|---|
| Flash Point | 142.4±23.8 °C |
|---|
| Exact Mass | 236.104858 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.51 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.522 |
|---|
| InChIKey | BTCQMCOBMIXUCG-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc(C=O)ccc1OC(=O)C(C)C |
|---|
Synonyms
| 2-ethoxy-4-formylphenyl acetate |
| 4-Acetoxy-3-aethoxy-benzaldehyd |
| vanillal acetate |
| 4-Acetoxy-3-ethoxybenzaldehyde |
| 2-Ethoxy-4-formylphenyl 2-methylpropanoate |
| 3-ethoxy4-isobutyryloxy-benzaldehyde |
| 4-formyl-2-ethoxyphenyl ethanoate |
| Propanoic acid, 2-methyl-, 2-ethoxy-4-formylphenyl ester |
| vanillal isobutyrate |
| 4-formyl-2-ethoxyphenyl isobutyrate |
| Ethyl vanillin acetate |
