Introduction：Basic information about CAS 18480-23-4|Allyl(triphenyl)phosphonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Allyl(triphenyl)phosphonium chloride |
|---|
| CAS Number | 18480-23-4 | Molecular Weight | 338.810 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C21H20ClP | Melting Point | 227-229 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | triphenyl(prop-2-enyl)phosphanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 227-229 °C |
|---|
| Molecular Formula | C21H20ClP |
|---|
| Molecular Weight | 338.810 |
|---|
| Exact Mass | 338.099121 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 1.17050 |
|---|
| InChIKey | FKMJROWWQOJRJX-UHFFFAOYSA-M |
|---|
| SMILES | C=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Allyltriphenylphosphoniumchlorid |
| EINECS 242-368-7 |
| MFCD00031542 |
| ALLYL-TRIPHENYL-PHOSPHONIUM,CHLORIDE |
| Phosphonium, triphenyl-2-propen-1-yl-, chloride (1:1) |
| Allyltriphenylphosphonium Chloride |
| Allyl triphenylphosphonium chloride |
| Allyl(triphenyl)phosphonium chloride |
| Allyl-triphenyl-phosphonium |
