Introduction：Basic information about CAS 18880-05-2|(3-Methoxybenzyl)(triphenyl)phosphonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-Methoxybenzyl)(triphenyl)phosphonium chloride |
|---|
| CAS Number | 18880-05-2 | Molecular Weight | 418.895 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C26H24ClOP | Melting Point | 268 °C(dec.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3-methoxyphenyl)methyl-triphenylphosphanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 268 °C(dec.) |
|---|
| Molecular Formula | C26H24ClOP |
|---|
| Molecular Weight | 418.895 |
|---|
| Exact Mass | 418.125336 |
|---|
| PSA | 22.82000 |
|---|
| LogP | 2.19330 |
|---|
| InChIKey | DPYDLIVUYPUXBV-UHFFFAOYSA-M |
|---|
| SMILES | COc1cccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1.[Cl-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (3-Methoxybenzyl)triphenylphosphonium Chloride |
| m-methoxybenzyltriphenylphosphonium chloride |
| Phosphonium, [(3-methoxyphenyl)methyl]triphenyl-, chloride (1:1) |
| 3-Methoxybenzyltriphenylphosphonium Chloride |
| (3-Methoxybenzyl)(triphenyl)phosphonium chloride |
| 3-methoxybenzyl(chloro)triphenylphosphorane |
| 3-methoxybenzyl(chloro)triphenyphosphine |
| (3-methoxyphenyl)methyl-triphenyl-phosphanium Chloride |
| ((3-methoxyphenyl)methyl)triphenylphosphonium chloride |
