Introduction:Basic information about CAS 1809-14-9|Dioctyl phosphonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dioctyl phosphonate |
|---|
| CAS Number | 1809-14-9 | Molecular Weight | 306.421 |
|---|
| Density | / | Boiling Point | 381.3±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H35O3P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.5±13.5 °C |
|---|
Names
| Name | dioctoxy(oxo)phosphanium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 381.3±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H35O3P |
|---|
| Molecular Weight | 306.421 |
|---|
| Flash Point | 203.5±13.5 °C |
|---|
| Exact Mass | 306.232391 |
|---|
| PSA | 59.00000 |
|---|
| LogP | 6.13 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| InChIKey | PLSFNSJUKGEOSL-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCO[P+](=O)OCCCCCCCC |
|---|
Safety Information
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 217-315-6 |
| Dioctyl phosphonate |
| Di(n-octyl)phosphite |
| Phosphonic acid,dioctyl ester |
| phosphorous acid dioctyl ester |
| dioctyl phosphite |
| Dioctylphosphit |
| Phosphonic acid, dioctyl ester |
| Phosphonsaeure-dioctylester |
| dioctyl hydrogen phosphite |