Introduction:Basic information about CAS 82637-57-8|(S)-2-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenylpropylamino)propionyl]-6,7-dimethoxy-1,2,3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-2-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenylpropylamino)propionyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid benzyl ester |
|---|
| CAS Number | 82637-57-8 | Molecular Weight | 588.69100 |
|---|
| Density | 1.191g/cm3 | Boiling Point | 738.4ºC at 760 mmHg |
|---|
| Molecular Formula | C34H40N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 400.4ºC |
|---|
Names
| Name | benzyl 2-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.191g/cm3 |
|---|
| Boiling Point | 738.4ºC at 760 mmHg |
|---|
| Molecular Formula | C34H40N2O7 |
|---|
| Molecular Weight | 588.69100 |
|---|
| Flash Point | 400.4ºC |
|---|
| Exact Mass | 588.28400 |
|---|
| PSA | 103.40000 |
|---|
| LogP | 4.57190 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | JZXQEVNCLGXAGD-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1Cc2cc(OC)c(OC)cc2CC1C(=O)OCc1ccccc1 |
|---|
Synonyms
| {3S-[2(R*(R*))],3R*}-2-(2-{[1-(ethoxycarbonyl)-3-phenylpropyl]amino}-1-oxopropyl)-1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid,phenylmethyl ester |
| Propanedinitrile,2-[[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]methylene] |
| {3-Methoxy-4-[bis-(2-chlor-ethyl)-amino]-benzyliden}-malononitril |
| {3S-[2(R*(R*))],3R*}-2-(2-{[1-(ethoxycarbonyl)-3-phenylpropyl]amino}-1-oxopropyl)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid,ethyl ester |