Introduction：Basic information about CAS 63623-61-0|Z-Gly-Gly-Nva-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Gly-Gly-Nva-OH |
|---|
| CAS Number | 63623-61-0 | Molecular Weight | 365.38100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 717.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H23N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 387.6ºC |
|---|
Names
| Name | 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]pentanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 717.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H23N3O6 |
|---|
| Molecular Weight | 365.38100 |
|---|
| Flash Point | 387.6ºC |
|---|
| Exact Mass | 365.15900 |
|---|
| PSA | 133.83000 |
|---|
| LogP | 1.57120 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | JCRKZZNOFDAGDT-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(NC(=O)CNC(=O)CNC(=O)OCc1ccccc1)C(=O)O |
|---|
