Introduction:Basic information about CAS 945116-83-6|Methanone, [4-(4-chlorophenyl)-1-piperazinyl](3,5-dimethyl-4-isoxazolyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(4-chlorophenyl)-1-piperazinyl](3,5-dimethyl-4-isoxazolyl) |
|---|
| CAS Number | 945116-83-6 | Molecular Weight | 319.78600 |
|---|
| Density | 1.277g/cm3 | Boiling Point | 537.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H18ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 278.8ºC |
|---|
Names
| Name | Methanone, [4-(4-chlorophenyl)-1-piperazinyl](3,5-dimethyl-4-isoxazolyl) |
|---|
Chemical & Physical Properties
| Density | 1.277g/cm3 |
|---|
| Boiling Point | 537.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H18ClN3O2 |
|---|
| Molecular Weight | 319.78600 |
|---|
| Flash Point | 278.8ºC |
|---|
| Exact Mass | 319.10900 |
|---|
| PSA | 49.58000 |
|---|
| LogP | 2.91010 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | MPAAEHZMULUALY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1noc(C)c1C(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
|---|