Introduction：Basic information about CAS 887351-05-5|Methanone, (3,5-dimethyl-4-isoxazolyl)[4-[4-(methylsulfonyl)-2-nitrophenyl]-1-pipera, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (3,5-dimethyl-4-isoxazolyl)[4-[4-(methylsulfonyl)-2-nitrophenyl]-1-piperazinyl]- |
|---|
| CAS Number | 887351-05-5 | Molecular Weight | 408.42900 |
|---|
| Density | 1.398g/cm3 | Boiling Point | 698.6ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20N4O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 376.3ºC |
|---|
Names
| Name | Methanone, (3,5-dimethyl-4-isoxazolyl)[4-[4-(methylsulfonyl)-2-nitrophenyl]-1-piperazinyl] |
|---|
Chemical & Physical Properties
| Density | 1.398g/cm3 |
|---|
| Boiling Point | 698.6ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20N4O6S |
|---|
| Molecular Weight | 408.42900 |
|---|
| Flash Point | 376.3ºC |
|---|
| Exact Mass | 408.11000 |
|---|
| PSA | 137.92000 |
|---|
| LogP | 3.17240 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | ICMUUYZUPDAHQD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1noc(C)c1C(=O)N1CCN(c2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])CC1 |
|---|
