Introduction：Basic information about CAS 775300-34-0|Ethanone, 1-[4-[4-[[3-(2-chlorophenyl)-5-methyl-4-isoxazolyl]carbonyl]-1-piperazinyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanone, 1-[4-[4-[[3-(2-chlorophenyl)-5-methyl-4-isoxazolyl]carbonyl]-1-piperazinyl]phenyl]- |
|---|
| CAS Number | 775300-34-0 | Molecular Weight | 423.89200 |
|---|
| Density | 1.281g/cm3 | Boiling Point | 660.9ºC at 760 mmHg |
|---|
| Molecular Formula | C23H22ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 353.5ºC |
|---|
Names
| Name | Ethanone, 1-[4-[4-[[3-(2-chlorophenyl)-5-methyl-4-isoxazolyl]carbonyl]-1-piperazinyl]phenyl] |
|---|
Chemical & Physical Properties
| Density | 1.281g/cm3 |
|---|
| Boiling Point | 660.9ºC at 760 mmHg |
|---|
| Molecular Formula | C23H22ClN3O3 |
|---|
| Molecular Weight | 423.89200 |
|---|
| Flash Point | 353.5ºC |
|---|
| Exact Mass | 423.13500 |
|---|
| PSA | 66.65000 |
|---|
| LogP | 4.47130 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | NKFPZUFETMEUTQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3c(-c4ccccc4Cl)noc3C)CC2)cc1 |
|---|
