Introduction：Basic information about CAS 640286-91-5|Methanone, [4-(3,5-dimethoxyphenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, [4-(3,5-dimethoxyphenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl)- |
|---|
| CAS Number | 640286-91-5 | Molecular Weight | 407.46200 |
|---|
| Density | 1.215g/cm3 | Boiling Point | 649.875ºC at 760 mmHg |
|---|
| Molecular Formula | C23H25N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 346.832ºC |
|---|
Names
| Name | Methanone, [4-(3,5-dimethoxyphenyl)-1-piperazinyl](5-methyl-3-phenyl-4-isoxazolyl) |
|---|
Chemical & Physical Properties
| Density | 1.215g/cm3 |
|---|
| Boiling Point | 649.875ºC at 760 mmHg |
|---|
| Molecular Formula | C23H25N3O4 |
|---|
| Molecular Weight | 407.46200 |
|---|
| Flash Point | 346.832ºC |
|---|
| Exact Mass | 407.18500 |
|---|
| PSA | 68.04000 |
|---|
| LogP | 3.63250 |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | GFHYHAMWWWMKJT-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)cc(N2CCN(C(=O)c3c(-c4ccccc4)noc3C)CC2)c1 |
|---|
