Introduction：Basic information about CAS 927186-53-6|2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy] |
|---|
| CAS Number | 927186-53-6 | Molecular Weight | 430.15500 |
|---|
| Density | 1.854g/cm3 | Boiling Point | 604.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11IN4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 319.5ºC |
|---|
Names
| Name | 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy] |
|---|
Chemical & Physical Properties
| Density | 1.854g/cm3 |
|---|
| Boiling Point | 604.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11IN4O5 |
|---|
| Molecular Weight | 430.15500 |
|---|
| Flash Point | 319.5ºC |
|---|
| Exact Mass | 429.97700 |
|---|
| PSA | 139.78000 |
|---|
| LogP | 4.33390 |
|---|
| Index of Refraction | 1.707 |
|---|
| InChIKey | SBDFFAAZZFZYLI-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(OCCc2ccc([N+](=O)[O-])cc2)c(I)cc1[N+](=O)[O-] |
|---|
