Introduction：Basic information about CAS 78218-09-4|Dazoxiben, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dazoxiben |
|---|
| CAS Number | 78218-09-4 | Molecular Weight | 232.23500 |
|---|
| Density | 1.25 g/cm3 | Boiling Point | 491.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O3 | Melting Point | 230-235°C |
|---|
| MSDS | / | Flash Point | 250.9ºC |
|---|
Names
| Name | Dazoxiben |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25 g/cm3 |
|---|
| Boiling Point | 491.2ºC at 760 mmHg |
|---|
| Melting Point | 230-235°C |
|---|
| Molecular Formula | C12H12N2O3 |
|---|
| Molecular Weight | 232.23500 |
|---|
| Flash Point | 250.9ºC |
|---|
| Exact Mass | 232.08500 |
|---|
| PSA | 64.35000 |
|---|
| LogP | 1.66030 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | XQGZSYKGWHUSDH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(OCCn2ccnc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22:Harmful if swallowed. R41:Risk of serious damage to eyes. |
|---|
| Safety Phrases | S37/39 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | DD6963500 |
|---|
Synonyms
| 1-[2-(4-carboxyphenoxy)ethyl]imidazole |
| MFCD00866791 |
| 4-[2-(1H-imidazol-1-yl)ethoxy]benzoic acid |
| 4-[2-(imidazol-1-yl)ethoxy]benzoic acid |
| 4-(2-(1-Imidazolyl)ethoxy)benzoesaeure |
| Dazoxibene [inn-french] |
| UK-37 |
| 4-[2-(1-imidazolyl)ethoxy]-benzoic acid |
