Introduction：Basic information about CAS 7149-76-0|1,4-dichloro-2-methyl-5-nitro-benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-dichloro-2-methyl-5-nitro-benzene |
|---|
| CAS Number | 7149-76-0 | Molecular Weight | 206.02600 |
|---|
| Density | 1.456g/cm3 | Boiling Point | 292.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 130.8ºC |
|---|
Names
| Name | 1,4-dichloro-2-methyl-5-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.456g/cm3 |
|---|
| Boiling Point | 292.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl2NO2 |
|---|
| Molecular Weight | 206.02600 |
|---|
| Flash Point | 130.8ºC |
|---|
| Exact Mass | 204.97000 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.73320 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | PEQYJEJKUTUIFJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)c([N+](=O)[O-])cc1Cl |
|---|
Synonyms
| 2,5-Dichloro-4-methyl-nitrobenzene |
| 2,5-Dichlor-4-nitro-toluol |
| 2,5-dichloro-4-nitro-toluene |
