Introduction:Basic information about CAS 33704-61-9|Cashmeran, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cashmeran |
|---|
| CAS Number | 33704-61-9 | Molecular Weight | 206.324 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 286.1±7.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H22O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127.0±9.0 °C |
|---|
Names
| Name | 1,1,2,3,3-pentamethyl-2,5,6,7-tetrahydroinden-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 286.1±7.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H22O |
|---|
| Molecular Weight | 206.324 |
|---|
| Flash Point | 127.0±9.0 °C |
|---|
| Exact Mass | 206.167068 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.06 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.495 |
|---|
| InChIKey | MIZGSAALSYARKU-UHFFFAOYSA-N |
|---|
| SMILES | CC1C(C)(C)C2=C(C(=O)CCC2)C1(C)C |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| HS Code | 2914190090 |
|---|
Customs
| HS Code | 2914190090 |
|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| UNII:BZR4438MY4 |
| 1,1,2,3,3-Pentamethyl-1,2,3,5,6,7-hexahydro-4H-inden-4-one |
| 1,1,2,3,3-pentamethyl2,3,4,5,6,7-hexahydroinden-4-one |
| 1,2,3,5,6,7-hexahydro-1,1,2,3,3-pentamethyl-4H-inden-4-one |
| DPMI |
| Cashmeran |
| EINECS 251-649-3 |
| 4H-Inden-4-one, 1,2,3,5,6,7-hexahydro-1,1,2,3,3-pentamethyl- |
| 4H-Inden-4-one,1,2,3,5,6,7-hexahydro-1,1,2,3,3-pentamethyl |