Introduction:Basic information about CAS 6345-63-7|2-Nitrobenzylidene di(acetate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Nitrobenzylidene di(acetate) |
|---|
| CAS Number | 6345-63-7 | Molecular Weight | 253.20800 |
|---|
| Density | 1.323g/cm3 | Boiling Point | 368.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.9ºC |
|---|
Names
| Name | [acetyloxy-(2-nitrophenyl)methyl] acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.323g/cm3 |
|---|
| Boiling Point | 368.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO6 |
|---|
| Molecular Weight | 253.20800 |
|---|
| Flash Point | 161.9ºC |
|---|
| Exact Mass | 253.05900 |
|---|
| PSA | 98.42000 |
|---|
| LogP | 2.24280 |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | PMZHONATLZBKIL-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OC(OC(C)=O)c1ccccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-diacetoxymethyl-2-nitro-benzene |
| 2-nitrobenzylidene diacetate |
| (o-nitrophenyl)methanediol diacetate |
| 2-NO2(C6H4)CH(OAc)2 |
| 1-Diacetoxymethyl-2-nitro-benzol |
| 2-nitrobenzaldehyde-1,1-diacetate |
| o-Nitrobenzal diacetate |
| 1,1-diacetoxy-1-(2-nitrophenyl)methane |
| (2-nitrophenyl)methylene diacetate |