Introduction:Basic information about CAS 183742-34-9|4-Boc-1-Fmoc-2-Piperazine acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Boc-1-Fmoc-2-Piperazine acetic acid |
|---|
| CAS Number | 183742-34-9 | Molecular Weight | 466.526 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 637.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H30N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 339.3±25.9 °C |
|---|
Names
| Name | 2-[1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 637.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H30N2O6 |
|---|
| Molecular Weight | 466.526 |
|---|
| Flash Point | 339.3±25.9 °C |
|---|
| Exact Mass | 466.210388 |
|---|
| PSA | 96.38000 |
|---|
| LogP | 3.82 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | XHEXEZVLDQGZFP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)C(CC(=O)O)C1 |
|---|
Safety Information
Synonyms
| N-4-Boc-N-1-Fmoc-2-piperazineaceticacid |
| {4-(tert-Butoxycarbonyl)-1-[(9H-fluoren-9-ylmethoxy)carbonyl]piperazin-2-yl}acetic acid |
| 1-n-fmoc-4-n-boc-piperazine-2-acetic acid |
| 4-boc-1-fmoc-2-piperazine acetic acid |
| 1-Fmoc-4-Boc-piperazine-2-acetic acid |
| MFCD00674206 |
| 4-N-BOC-1-N-FMOC-2-piperazine acetic acid |
| 4-Boc-1-Fmoc-piperazine-2-acetic acid |
| (1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinyl)acetic acid |
| 1,4-Piperazinedicarboxylic acid, 2-(carboxymethyl)-, 4-(1,1-dimethylethyl) 1-(9H-fluoren-9-ylmethyl) ester |