Introduction:Basic information about CAS 82117-51-9|Cinuperone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cinuperone |
|---|
| CAS Number | 82117-51-9 | Molecular Weight | 377.45500 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 576.9ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24FN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 302.7ºC |
|---|
Names
| Name | 1-(4-fluorophenyl)-4-(4-isoquinolin-3-ylpiperazin-1-yl)butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 576.9ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24FN3O |
|---|
| Molecular Weight | 377.45500 |
|---|
| Flash Point | 302.7ºC |
|---|
| Exact Mass | 377.19000 |
|---|
| PSA | 36.44000 |
|---|
| LogP | 4.16190 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | YLCFZLMWTUMGKY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCCN1CCN(c2cc3ccccc3cn2)CC1)c1ccc(F)cc1 |
|---|
Synonyms
| UNII-072Z5ZP2FI |
| Cinuperone |
| Cinuperonum |
| Cinuperone [INN] |