Introduction:Basic information about CAS 58662-84-3|Meclonazepam, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Meclonazepam |
|---|
| CAS Number | 58662-84-3 | Molecular Weight | 329.73800 |
|---|
| Density | 1.46 | Boiling Point | 522.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 269.6ºC |
|---|
Names
| Name | (3S)-5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.46 |
|---|
| Boiling Point | 522.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12ClN3O3 |
|---|
| Molecular Weight | 329.73800 |
|---|
| Flash Point | 269.6ºC |
|---|
| Exact Mass | 329.05700 |
|---|
| PSA | 87.28000 |
|---|
| LogP | 3.52300 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | LMUVYJCAFWGNSY-VIFPVBQESA-N |
|---|
| SMILES | CC1N=C(c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2NC1=O |
|---|
Synonyms
| Meclonazepam [INN] |
| Meclonazepam,(S)-isomer |
| Meclonazepamum [INN-Latin] |
| Meclonazepamum |
| 3(S)-Methylclonazepam |
| Meclonazepam |