Introduction:Basic information about CAS 4747-99-3|norlaudanosoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | norlaudanosoline |
|---|
| CAS Number | 4747-99-3 | Molecular Weight | 287.31000 |
|---|
| Density | 1.406g/cm3 | Boiling Point | 573.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.1ºC |
|---|
Names
| Name | norlaudanosoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.406g/cm3 |
|---|
| Boiling Point | 573.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H17NO4 |
|---|
| Molecular Weight | 287.31000 |
|---|
| Flash Point | 235.1ºC |
|---|
| Exact Mass | 287.11600 |
|---|
| PSA | 92.95000 |
|---|
| LogP | 2.26730 |
|---|
| Index of Refraction | 1.694 |
|---|
| InChIKey | ABXZOXDTHTTZJW-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(CC2NCCc3cc(O)c(O)cc32)cc1O |
|---|
Synonyms
| 1-(3,4-Dihydroxybenzyl)-1,2,3,4-tetrahydro-6,7-isoquinolinediol |
| 1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Tetrahydroxypapaveroline |
| 1-(3,4-dihydroxybenzyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Norlaudanosoline |
| (+/-)-tetrahydropapaveroline |
| (R,S)-Norlaudanosoline |
| 6,7-Isoquinolinediol,1-((3,4-dihydroxyphenyl)methyl)-1,2,3,4-tetrahydro |