Introduction：Basic information about CAS 71461-18-2|Tonazocine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tonazocine |
|---|
| CAS Number | 71461-18-2 | Molecular Weight | 357.53000 |
|---|
| Density | 1.03g/cm3 | Boiling Point | 479.3ºC at 760 mmHg |
|---|
| Molecular Formula | C23H35NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.03g/cm3 |
|---|
| Boiling Point | 479.3ºC at 760 mmHg |
|---|
| Molecular Formula | C23H35NO2 |
|---|
| Molecular Weight | 357.53000 |
|---|
| Flash Point | 243.7ºC |
|---|
| Exact Mass | 357.26700 |
|---|
| PSA | 40.54000 |
|---|
| LogP | 4.78390 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | UDNUCVYCLQJJBY-XPWALMASSA-N |
|---|
| SMILES | CCCCCC(=O)CCC1(C)C2Cc3ccc(O)cc3C1(C)CCN2C |
|---|
